C16H15N5O3S2 — CID 137215388
1-(2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea (PubChem CID 137215388) has the molecular formula C16H15N5O3S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-(2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea.
| Compound Name | 1-(2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137215388 |
| Molecular Formula | C16H15N5O3S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1-(2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea |
| SMILES | Cn1c(O)c(/N=N/C(=S)Nc2cccc(S(N)(=O)=O)c2)c2ccccc21 |
| InChI | InChI=1S/C16H15N5O3S2/c1-21-13-8-3-2-7-12(13)14(15(21)22)19-20-16(25)18-10-5-4-6-11(9-10)26(17,23)24/h2-9,22H,1H3,(H,18,25)(H2,17,23,24)/b20-19+ |
| InChIKey | RGNMIUGTROPMTR-FMQUCBEESA-N |
| XLogP | 3.01 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|