C18H18N4OS — CID 135597183
1-(2-hydroxy-1-methylindol-3-yl)imino-3-(2-phenylethyl)thiourea (PubChem CID 135597183) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-(2-hydroxy-1-methylindol-3-yl)imino-3-(2-phenylethyl)thiourea.
| Compound Name | 1-(2-hydroxy-1-methylindol-3-yl)imino-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 135597183 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-(2-hydroxy-1-methylindol-3-yl)imino-3-(2-phenylethyl)thiourea |
| SMILES | Cn1c(O)c(/N=N/C(=S)NCCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H18N4OS/c1-22-15-10-6-5-9-14(15)16(17(22)23)20-21-18(24)19-12-11-13-7-3-2-4-8-13/h2-10,23H,11-12H2,1H3,(H,19,24)/b21-20+ |
| InChIKey | FASRJWUZPLTHGC-QZQOTICOSA-N |
| XLogP | 4.08 |
| TPSA | 61.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|