C16H14ClN5O3S2 — CID 137197136
1-(7-chloro-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea (PubChem CID 137197136) has the molecular formula C16H14ClN5O3S2 and a molecular weight of 423.91 g/mol. Its IUPAC name is 1-(7-chloro-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea.
| Compound Name | 1-(7-chloro-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137197136 |
| Molecular Formula | C16H14ClN5O3S2 |
| Molecular Weight | 423.91 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 1-(7-chloro-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea |
| SMILES | Cn1c(O)c(/N=N/C(=S)Nc2ccccc2S(N)(=O)=O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C16H14ClN5O3S2/c1-22-14-9(5-4-6-10(14)17)13(15(22)23)20-21-16(26)19-11-7-2-3-8-12(11)27(18,24)25/h2-8,23H,1H3,(H,19,26)(H2,18,24,25)/b21-20+ |
| InChIKey | QVSMMKBOTSGWQT-QZQOTICOSA-N |
| XLogP | 3.67 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|