C23H17BrF3N5O3S2 — CID 137197168
1-[6-bromo-2-hydroxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea (PubChem CID 137197168) has the molecular formula C23H17BrF3N5O3S2 and a molecular weight of 612.45 g/mol. Its IUPAC name is 1-[6-bromo-2-hydroxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea.
| Compound Name | 1-[6-bromo-2-hydroxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137197168 |
| Molecular Formula | C23H17BrF3N5O3S2 |
| Molecular Weight | 612.45 g/mol |
| Exact Mass | 610.99 |
| IUPAC Name | 1-[6-bromo-2-hydroxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccccc1NC(=S)/N=N/c1c(O)n(Cc2ccccc2C(F)(F)F)c2cc(Br)ccc12 |
| InChI | InChI=1S/C23H17BrF3N5O3S2/c24-14-9-10-15-18(11-14)32(12-13-5-1-2-6-16(13)23(25,26)27)21(33)20(15)30-31-22(36)29-17-7-3-4-8-19(17)37(28,34)35/h1-11,33H,12H2,(H,29,36)(H2,28,34,35)/b31-30+ |
| InChIKey | KJVFEBHRXKTSBO-NVQSTNCTSA-N |
| XLogP | 6.30 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|