C17H16BrN5O3S2 — CID 137196998
1-(6-bromo-1-ethyl-2-hydroxyindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea (PubChem CID 137196998) has the molecular formula C17H16BrN5O3S2 and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-(6-bromo-1-ethyl-2-hydroxyindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea.
| Compound Name | 1-(6-bromo-1-ethyl-2-hydroxyindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137196998 |
| Molecular Formula | C17H16BrN5O3S2 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 1-(6-bromo-1-ethyl-2-hydroxyindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea |
| SMILES | CCn1c(O)c(/N=N/C(=S)Nc2ccccc2S(N)(=O)=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C17H16BrN5O3S2/c1-2-23-13-9-10(18)7-8-11(13)15(16(23)24)21-22-17(27)20-12-5-3-4-6-14(12)28(19,25)26/h3-9,24H,2H2,1H3,(H,20,27)(H2,19,25,26)/b22-21+ |
| InChIKey | XCIIHXIWDUEEPW-QURGRASLSA-N |
| XLogP | 4.26 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|