C26H20ClN5O3S2 — CID 137196908
1-[7-chloro-2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea (PubChem CID 137196908) has the molecular formula C26H20ClN5O3S2 and a molecular weight of 550.07 g/mol. Its IUPAC name is 1-[7-chloro-2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea.
| Compound Name | 1-[7-chloro-2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137196908 |
| Molecular Formula | C26H20ClN5O3S2 |
| Molecular Weight | 550.07 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 1-[7-chloro-2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccccc1NC(=S)/N=N/c1c(O)n(Cc2cccc3ccccc23)c2c(Cl)cccc12 |
| InChI | InChI=1S/C26H20ClN5O3S2/c27-20-12-6-11-19-23(30-31-26(36)29-21-13-3-4-14-22(21)37(28,34)35)25(33)32(24(19)20)15-17-9-5-8-16-7-1-2-10-18(16)17/h1-14,33H,15H2,(H,29,36)(H2,28,34,35)/b31-30+ |
| InChIKey | LEWOIDMBYKAKNK-NVQSTNCTSA-N |
| XLogP | 6.33 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.07 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|