C27H20F3N5O3S2 — CID 137196880
1-[2-hydroxy-1-(naphthalen-1-ylmethyl)-7-(trifluoromethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea (PubChem CID 137196880) has the molecular formula C27H20F3N5O3S2 and a molecular weight of 583.62 g/mol. Its IUPAC name is 1-[2-hydroxy-1-(naphthalen-1-ylmethyl)-7-(trifluoromethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea.
| Compound Name | 1-[2-hydroxy-1-(naphthalen-1-ylmethyl)-7-(trifluoromethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137196880 |
| Molecular Formula | C27H20F3N5O3S2 |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.10 |
| IUPAC Name | 1-[2-hydroxy-1-(naphthalen-1-ylmethyl)-7-(trifluoromethyl)indol-3-yl]imino-3-(2-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccccc1NC(=S)/N=N/c1c(O)n(Cc2cccc3ccccc23)c2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C27H20F3N5O3S2/c28-27(29,30)20-12-6-11-19-23(33-34-26(39)32-21-13-3-4-14-22(21)40(31,37)38)25(36)35(24(19)20)15-17-9-5-8-16-7-1-2-10-18(16)17/h1-14,36H,15H2,(H,32,39)(H2,31,37,38)/b34-33+ |
| InChIKey | FYOIDXRSPYLQEJ-JEIPZWNWSA-N |
| XLogP | 6.70 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|