C16H13Br2N5O3S2 — CID 137197012
1-(5,7-dibromo-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea (PubChem CID 137197012) has the molecular formula C16H13Br2N5O3S2 and a molecular weight of 547.25 g/mol. Its IUPAC name is 1-(5,7-dibromo-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea.
| Compound Name | 1-(5,7-dibromo-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137197012 |
| Molecular Formula | C16H13Br2N5O3S2 |
| Molecular Weight | 547.25 g/mol |
| Exact Mass | 544.88 |
| IUPAC Name | 1-(5,7-dibromo-2-hydroxy-1-methylindol-3-yl)imino-3-(2-sulfamoylphenyl)thiourea |
| SMILES | Cn1c(O)c(/N=N/C(=S)Nc2ccccc2S(N)(=O)=O)c2cc(Br)cc(Br)c21 |
| InChI | InChI=1S/C16H13Br2N5O3S2/c1-23-14-9(6-8(17)7-10(14)18)13(15(23)24)21-22-16(27)20-11-4-2-3-5-12(11)28(19,25)26/h2-7,24H,1H3,(H,20,27)(H2,19,25,26)/b22-21+ |
| InChIKey | ZHWWODRPVBLZHJ-QURGRASLSA-N |
| XLogP | 4.54 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|