C17H15N3O5S — CID 54676685
4-hydroxy-1-methyl-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide (PubChem CID 54676685) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide.
| Compound Name | 4-hydroxy-1-methyl-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 54676685 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-hydroxy-1-methyl-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2ccccc2S(N)(=O)=O)c(O)c2ccccc21 |
| InChI | InChI=1S/C17H15N3O5S/c1-20-12-8-4-2-6-10(12)15(21)14(17(20)23)16(22)19-11-7-3-5-9-13(11)26(18,24)25/h2-9,21H,1H3,(H,19,22)(H2,18,24,25) |
| InChIKey | LJTIFLVJMOSVDO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |