C20H21N3O5S — CID 54679933
1-butan-2-yl-4-hydroxy-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide (PubChem CID 54679933) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 1-butan-2-yl-4-hydroxy-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide.
| Compound Name | 1-butan-2-yl-4-hydroxy-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 54679933 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-butan-2-yl-4-hydroxy-2-oxo-N-(2-sulfamoylphenyl)quinoline-3-carboxamide |
| SMILES | CCC(C)n1c(=O)c(C(=O)Nc2ccccc2S(N)(=O)=O)c(O)c2ccccc21 |
| InChI | InChI=1S/C20H21N3O5S/c1-3-12(2)23-15-10-6-4-8-13(15)18(24)17(20(23)26)19(25)22-14-9-5-7-11-16(14)29(21,27)28/h4-12,24H,3H2,1-2H3,(H,22,25)(H2,21,27,28) |
| InChIKey | OYQKSESMHSMUDW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |