C22H24N2O3 — CID 54678423
4-hydroxy-N-(3-methylphenyl)-2-oxo-1-pentylquinoline-3-carboxamide (PubChem CID 54678423) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-hydroxy-N-(3-methylphenyl)-2-oxo-1-pentylquinoline-3-carboxamide.
| Compound Name | 4-hydroxy-N-(3-methylphenyl)-2-oxo-1-pentylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54678423 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-hydroxy-N-(3-methylphenyl)-2-oxo-1-pentylquinoline-3-carboxamide |
| SMILES | CCCCCn1c(=O)c(C(=O)Nc2cccc(C)c2)c(O)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O3/c1-3-4-7-13-24-18-12-6-5-11-17(18)20(25)19(22(24)27)21(26)23-16-10-8-9-15(2)14-16/h5-6,8-12,14,25H,3-4,7,13H2,1-2H3,(H,23,26) |
| InChIKey | CLODMSNWJKAEQT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|