C27H32N2O5 — CID 131984445
2-butyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid (PubChem CID 131984445) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-butyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-butyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 131984445 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-butyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid |
| SMILES | CCCCCCn1c(=O)c(C(=O)Nc2ccc(C(=O)O)c(CCCC)c2)c(O)c2ccccc21 |
| InChI | InChI=1S/C27H32N2O5/c1-3-5-7-10-16-29-22-13-9-8-12-21(22)24(30)23(26(29)32)25(31)28-19-14-15-20(27(33)34)18(17-19)11-6-4-2/h8-9,12-15,17,30H,3-7,10-11,16H2,1-2H3,(H,28,31)(H,33,34) |
| InChIKey | HUELSLDOVWKERV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|