C30H30N2O5 — CID 131984444
2-benzyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid (PubChem CID 131984444) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-benzyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-benzyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 131984444 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-benzyl-4-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]benzoic acid |
| SMILES | CCCCCCn1c(=O)c(C(=O)Nc2ccc(C(=O)O)c(Cc3ccccc3)c2)c(O)c2ccccc21 |
| InChI | InChI=1S/C30H30N2O5/c1-2-3-4-10-17-32-25-14-9-8-13-24(25)27(33)26(29(32)35)28(34)31-22-15-16-23(30(36)37)21(19-22)18-20-11-6-5-7-12-20/h5-9,11-16,19,33H,2-4,10,17-18H2,1H3,(H,31,34)(H,36,37) |
| InChIKey | CXVHGLHEFFSIMY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|