C24H28N2O3 — CID 54677434
N-(2,5-dimethylphenyl)-1-hexyl-4-hydroxy-2-oxoquinoline-3-carboxamide (PubChem CID 54677434) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1-hexyl-4-hydroxy-2-oxoquinoline-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-1-hexyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54677434 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1-hexyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
| SMILES | CCCCCCn1c(=O)c(C(=O)Nc2cc(C)ccc2C)c(O)c2ccccc21 |
| InChI | InChI=1S/C24H28N2O3/c1-4-5-6-9-14-26-20-11-8-7-10-18(20)22(27)21(24(26)29)23(28)25-19-15-16(2)12-13-17(19)3/h7-8,10-13,15,27H,4-6,9,14H2,1-3H3,(H,25,28) |
| InChIKey | XYKOAYLTAVWVBD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|