C20H20N2O3 — CID 54684059
4-hydroxy-N-(2-methylphenyl)-2-oxo-1-propylquinoline-3-carboxamide (PubChem CID 54684059) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-hydroxy-N-(2-methylphenyl)-2-oxo-1-propylquinoline-3-carboxamide.
| Compound Name | 4-hydroxy-N-(2-methylphenyl)-2-oxo-1-propylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54684059 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-hydroxy-N-(2-methylphenyl)-2-oxo-1-propylquinoline-3-carboxamide |
| SMILES | CCCn1c(=O)c(C(=O)Nc2ccccc2C)c(O)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O3/c1-3-12-22-16-11-7-5-9-14(16)18(23)17(20(22)25)19(24)21-15-10-6-4-8-13(15)2/h4-11,23H,3,12H2,1-2H3,(H,21,24) |
| InChIKey | IQXRVKPAGTURSD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |