C25H30N2O4 — CID 54681664
N-(4-ethoxyphenyl)-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide (PubChem CID 54681664) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54681664 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-(4-ethoxyphenyl)-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
| SMILES | CCCCCCCn1c(=O)c(C(=O)Nc2ccc(OCC)cc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C25H30N2O4/c1-3-5-6-7-10-17-27-21-12-9-8-11-20(21)23(28)22(25(27)30)24(29)26-18-13-15-19(16-14-18)31-4-2/h8-9,11-16,28H,3-7,10,17H2,1-2H3,(H,26,29) |
| InChIKey | CFMAPSNWUVLVAJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|