C20H23N3O3S — CID 89188317
1-heptyl-4-hydroxy-2-oxo-N-(1,3-thiazol-2-yl)quinoline-3-carboxamide (PubChem CID 89188317) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-heptyl-4-hydroxy-2-oxo-N-(1,3-thiazol-2-yl)quinoline-3-carboxamide.
| Compound Name | 1-heptyl-4-hydroxy-2-oxo-N-(1,3-thiazol-2-yl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 89188317 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-heptyl-4-hydroxy-2-oxo-N-(1,3-thiazol-2-yl)quinoline-3-carboxamide |
| SMILES | CCCCCCCn1c(=O)c(C(=O)Nc2nccs2)c(O)c2ccccc21 |
| InChI | InChI=1S/C20H23N3O3S/c1-2-3-4-5-8-12-23-15-10-7-6-9-14(15)17(24)16(19(23)26)18(25)22-20-21-11-13-27-20/h6-7,9-11,13,24H,2-5,8,12H2,1H3,(H,21,22,25) |
| InChIKey | MHCCJPOSGQNASO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|