C22H22N2O5 — CID 54717945
[4-[(4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl)amino]phenyl] 2,2-dimethylpropanoate (PubChem CID 54717945) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [4-[(4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl)amino]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl)amino]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54717945 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [4-[(4-hydroxy-1-methyl-2-oxoquinoline-3-carbonyl)amino]phenyl] 2,2-dimethylpropanoate |
| SMILES | Cn1c(=O)c(C(=O)Nc2ccc(OC(=O)C(C)(C)C)cc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C22H22N2O5/c1-22(2,3)21(28)29-14-11-9-13(10-12-14)23-19(26)17-18(25)15-7-5-6-8-16(15)24(4)20(17)27/h5-12,25H,1-4H3,(H,23,26) |
| InChIKey | IMPVUVWGFWWATR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|