C21H21IN2O3 — CID 54693217
1-(2,2-dimethylpropyl)-4-hydroxy-N-(4-iodophenyl)-2-oxoquinoline-3-carboxamide (PubChem CID 54693217) has the molecular formula C21H21IN2O3 and a molecular weight of 476.31 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4-hydroxy-N-(4-iodophenyl)-2-oxoquinoline-3-carboxamide.
| Compound Name | 1-(2,2-dimethylpropyl)-4-hydroxy-N-(4-iodophenyl)-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54693217 |
| Molecular Formula | C21H21IN2O3 |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4-hydroxy-N-(4-iodophenyl)-2-oxoquinoline-3-carboxamide |
| SMILES | CC(C)(C)Cn1c(=O)c(C(=O)Nc2ccc(I)cc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C21H21IN2O3/c1-21(2,3)12-24-16-7-5-4-6-15(16)18(25)17(20(24)27)19(26)23-14-10-8-13(22)9-11-14/h4-11,25H,12H2,1-3H3,(H,23,26) |
| InChIKey | SHMLGGSABYBSMM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|