C23H25N5O5S2 — CID 4120407
1-(2-hydroxy-5-morpholin-4-ylsulfonyl-1-prop-2-enylindol-3-yl)imino-3-(4-methoxyphenyl)thiourea (PubChem CID 4120407) has the molecular formula C23H25N5O5S2 and a molecular weight of 515.62 g/mol. Its IUPAC name is 1-(2-hydroxy-5-morpholin-4-ylsulfonyl-1-prop-2-enylindol-3-yl)imino-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-(2-hydroxy-5-morpholin-4-ylsulfonyl-1-prop-2-enylindol-3-yl)imino-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 4120407 |
| Molecular Formula | C23H25N5O5S2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 1-(2-hydroxy-5-morpholin-4-ylsulfonyl-1-prop-2-enylindol-3-yl)imino-3-(4-methoxyphenyl)thiourea |
| SMILES | C=CCn1c(O)c(/N=N/C(=S)Nc2ccc(OC)cc2)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C23H25N5O5S2/c1-3-10-28-20-9-8-18(35(30,31)27-11-13-33-14-12-27)15-19(20)21(22(28)29)25-26-23(34)24-16-4-6-17(32-2)7-5-16/h3-9,15,29H,1,10-14H2,2H3,(H,24,34)/b26-25+ |
| InChIKey | CXRSZRNZTQQKEG-OCEACIFDSA-N |
| XLogP | 4.04 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|