C27H24ClFN4O4S2 — CID 135442890
N-[1-[(4-chlorophenyl)methyl]-2-hydroxy-5-morpholin-4-ylsulfonylindol-3-yl]imino-2-(2-fluorophenyl)ethanethioamide (PubChem CID 135442890) has the molecular formula C27H24ClFN4O4S2 and a molecular weight of 587.10 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]-2-hydroxy-5-morpholin-4-ylsulfonylindol-3-yl]imino-2-(2-fluorophenyl)ethanethioamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]-2-hydroxy-5-morpholin-4-ylsulfonylindol-3-yl]imino-2-(2-fluorophenyl)ethanethioamide |
|---|---|
| PubChem CID | 135442890 |
| Molecular Formula | C27H24ClFN4O4S2 |
| Molecular Weight | 587.10 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]-2-hydroxy-5-morpholin-4-ylsulfonylindol-3-yl]imino-2-(2-fluorophenyl)ethanethioamide |
| SMILES | O=S(=O)(c1ccc2c(c1)c(/N=N/C(=S)Cc1ccccc1F)c(O)n2Cc1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H24ClFN4O4S2/c28-20-7-5-18(6-8-20)17-33-24-10-9-21(39(35,36)32-11-13-37-14-12-32)16-22(24)26(27(33)34)31-30-25(38)15-19-3-1-2-4-23(19)29/h1-10,16,34H,11-15,17H2/b31-30+ |
| InChIKey | WLMDBSZHWSATLX-NVQSTNCTSA-N |
| XLogP | 5.86 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.10 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|