C22H24N4O5S — CID 2352943
N-(2-hydroxy-1-methylindol-3-yl)imino-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 2352943) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-(2-hydroxy-1-methylindol-3-yl)imino-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-(2-hydroxy-1-methylindol-3-yl)imino-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 2352943 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-(2-hydroxy-1-methylindol-3-yl)imino-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O5S/c1-25-19-5-3-2-4-18(19)21(22(25)28)24-23-20(27)11-8-16-6-9-17(10-7-16)32(29,30)26-12-14-31-15-13-26/h2-7,9-10,28H,8,11-15H2,1H3/b24-23+ |
| InChIKey | YCQOLKARVHIWBN-WCWDXBQESA-N |
| XLogP | 3.15 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|