C16H21NO6S — CID 55316342
2-oxopropyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate (PubChem CID 55316342) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-oxopropyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate.
| Compound Name | 2-oxopropyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 55316342 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-oxopropyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
| SMILES | CC(=O)COC(=O)CCc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H21NO6S/c1-13(18)12-23-16(19)7-4-14-2-5-15(6-3-14)24(20,21)17-8-10-22-11-9-17/h2-3,5-6H,4,7-12H2,1H3 |
| InChIKey | RYWCGPVKXWFFOV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |