C21H25NO5S — CID 7824832
(4-methylphenyl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate (PubChem CID 7824832) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate.
| Compound Name | (4-methylphenyl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 7824832 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (4-methylphenyl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
| SMILES | Cc1ccc(COC(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-17-2-4-19(5-3-17)16-27-21(23)11-8-18-6-9-20(10-7-18)28(24,25)22-12-14-26-15-13-22/h2-7,9-10H,8,11-16H2,1H3 |
| InChIKey | DWEPKRJUVMOUQL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |