C22H22ClNO5S2 — CID 24529793
(3-chloro-1-benzothiophen-2-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate (PubChem CID 24529793) has the molecular formula C22H22ClNO5S2 and a molecular weight of 480.01 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 24529793 |
| Molecular Formula | C22H22ClNO5S2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)OCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H22ClNO5S2/c23-22-18-3-1-2-4-19(18)30-20(22)15-29-21(25)10-7-16-5-8-17(9-6-16)31(26,27)24-11-13-28-14-12-24/h1-6,8-9H,7,10-15H2 |
| InChIKey | RXUZJIKQSBSDCD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |