C19H19BrClNO5S — CID 26664818
(2-bromo-4-chlorophenyl) 3-(4-morpholin-4-ylsulfonylphenyl)propanoate (PubChem CID 26664818) has the molecular formula C19H19BrClNO5S and a molecular weight of 488.79 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 3-(4-morpholin-4-ylsulfonylphenyl)propanoate.
| Compound Name | (2-bromo-4-chlorophenyl) 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 26664818 |
| Molecular Formula | C19H19BrClNO5S |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)Oc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C19H19BrClNO5S/c20-17-13-15(21)4-7-18(17)27-19(23)8-3-14-1-5-16(6-2-14)28(24,25)22-9-11-26-12-10-22/h1-2,4-7,13H,3,8-12H2 |
| InChIKey | VELKFPYARPVYPM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|