C23H23ClN2O5S — CID 29352401
(2-chloroquinolin-3-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate (PubChem CID 29352401) has the molecular formula C23H23ClN2O5S and a molecular weight of 474.97 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate.
| Compound Name | (2-chloroquinolin-3-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 29352401 |
| Molecular Formula | C23H23ClN2O5S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)OCc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C23H23ClN2O5S/c24-23-19(15-18-3-1-2-4-21(18)25-23)16-31-22(27)10-7-17-5-8-20(9-6-17)32(28,29)26-11-13-30-14-12-26/h1-6,8-9,15H,7,10-14,16H2 |
| InChIKey | CTYFGWBLEWHZSU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|