C27H30N2O4S — CID 47081612
3-(4-morpholin-4-ylsulfonylphenyl)-N-phenyl-N-(2-phenylethyl)propanamide (PubChem CID 47081612) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-N-phenyl-N-(2-phenylethyl)propanamide.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-phenyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 47081612 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-phenyl-N-(2-phenylethyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)N(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O4S/c30-27(29(25-9-5-2-6-10-25)18-17-23-7-3-1-4-8-23)16-13-24-11-14-26(15-12-24)34(31,32)28-19-21-33-22-20-28/h1-12,14-15H,13,16-22H2 |
| InChIKey | WUAWGLRWFSVCPX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |