C19H17ClN2O5S2 — CID 25386928
(2-chloroquinolin-3-yl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate (PubChem CID 25386928) has the molecular formula C19H17ClN2O5S2 and a molecular weight of 452.94 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate.
| Compound Name | (2-chloroquinolin-3-yl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 25386928 |
| Molecular Formula | C19H17ClN2O5S2 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate |
| SMILES | O=C(OCc1cc2ccccc2nc1Cl)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H17ClN2O5S2/c20-18-14(11-13-3-1-2-4-15(13)21-18)12-27-19(23)17-16(5-10-28-17)29(24,25)22-6-8-26-9-7-22/h1-5,10-11H,6-9,12H2 |
| InChIKey | DNKHOBJZESPOME-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|