C11H14N2O5S2 — CID 33079593
(2-amino-2-oxoethyl) 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate (PubChem CID 33079593) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 33079593 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate |
| SMILES | NC(=O)COC(=O)c1sccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C11H14N2O5S2/c12-9(14)7-18-11(15)10-8(3-6-19-10)20(16,17)13-4-1-2-5-13/h3,6H,1-2,4-5,7H2,(H2,12,14) |
| InChIKey | IZVCODOWKFKBKI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |