C16H16ClNO4S2 — CID 43036337
(4-chlorophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate (PubChem CID 43036337) has the molecular formula C16H16ClNO4S2 and a molecular weight of 385.89 g/mol. Its IUPAC name is (4-chlorophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate.
| Compound Name | (4-chlorophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 43036337 |
| Molecular Formula | C16H16ClNO4S2 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | (4-chlorophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H16ClNO4S2/c17-12-4-6-13(7-5-12)22-16(19)15-14(8-11-23-15)24(20,21)18-9-2-1-3-10-18/h4-8,11H,1-3,9-10H2 |
| InChIKey | BFXQJJALLPMBMP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|