C17H18N2O7S2 — CID 55465740
(4-methoxy-2-nitrophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate (PubChem CID 55465740) has the molecular formula C17H18N2O7S2 and a molecular weight of 426.47 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate.
| Compound Name | (4-methoxy-2-nitrophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55465740 |
| Molecular Formula | C17H18N2O7S2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 3-piperidin-1-ylsulfonylthiophene-2-carboxylate |
| SMILES | COc1ccc(OC(=O)c2sccc2S(=O)(=O)N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O7S2/c1-25-12-5-6-14(13(11-12)19(21)22)26-17(20)16-15(7-10-27-16)28(23,24)18-8-3-2-4-9-18/h5-7,10-11H,2-4,8-9H2,1H3 |
| InChIKey | GNAQDMNXGLFWRA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|