C17H19BrN2O4S2 — CID 60621527
N-[(3-bromo-4-methoxyphenyl)methyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 60621527) has the molecular formula C17H19BrN2O4S2 and a molecular weight of 459.39 g/mol. Its IUPAC name is N-[(3-bromo-4-methoxyphenyl)methyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[(3-bromo-4-methoxyphenyl)methyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60621527 |
| Molecular Formula | C17H19BrN2O4S2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | N-[(3-bromo-4-methoxyphenyl)methyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2sccc2S(=O)(=O)N2CCCC2)cc1Br |
| InChI | InChI=1S/C17H19BrN2O4S2/c1-24-14-5-4-12(10-13(14)18)11-19-17(21)16-15(6-9-25-16)26(22,23)20-7-2-3-8-20/h4-6,9-10H,2-3,7-8,11H2,1H3,(H,19,21) |
| InChIKey | ZONZSWAENXSCFH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |