C21H24N2O7S — CID 55340942
(4-methoxy-2-nitrophenyl) 3-(4-piperidin-1-ylsulfonylphenyl)propanoate (PubChem CID 55340942) has the molecular formula C21H24N2O7S and a molecular weight of 448.50 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 3-(4-piperidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | (4-methoxy-2-nitrophenyl) 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 55340942 |
| Molecular Formula | C21H24N2O7S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
| SMILES | COc1ccc(OC(=O)CCc2ccc(S(=O)(=O)N3CCCCC3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N2O7S/c1-29-17-8-11-20(19(15-17)23(25)26)30-21(24)12-7-16-5-9-18(10-6-16)31(27,28)22-13-3-2-4-14-22/h5-6,8-11,15H,2-4,7,12-14H2,1H3 |
| InChIKey | ZLFFHPKLPRHLKO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|