C21H26N4O6S — CID 26438465
N-(4-methoxy-2-nitrophenyl)-2-(2-methyl-5-piperidin-1-ylsulfonylanilino)acetamide (PubChem CID 26438465) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-(2-methyl-5-piperidin-1-ylsulfonylanilino)acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-(2-methyl-5-piperidin-1-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 26438465 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-(2-methyl-5-piperidin-1-ylsulfonylanilino)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2cc(S(=O)(=O)N3CCCCC3)ccc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N4O6S/c1-15-6-8-17(32(29,30)24-10-4-3-5-11-24)13-19(15)22-14-21(26)23-18-9-7-16(31-2)12-20(18)25(27)28/h6-9,12-13,22H,3-5,10-11,14H2,1-2H3,(H,23,26) |
| InChIKey | OHWRTCFKYBSMDK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|