C12H16N2O5S2 — CID 71941403
4-(4-methoxy-2-nitrophenyl)sulfonyl-1,4-thiazepane (PubChem CID 71941403) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-(4-methoxy-2-nitrophenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 4-(4-methoxy-2-nitrophenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 71941403 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-(4-methoxy-2-nitrophenyl)sulfonyl-1,4-thiazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCCSCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O5S2/c1-19-10-3-4-12(11(9-10)14(15)16)21(17,18)13-5-2-7-20-8-6-13/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | BVYRNMYGRRDSLK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|