C16H24N2O5S2 — CID 33080715
[2-(3-methylbutylamino)-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate (PubChem CID 33080715) has the molecular formula C16H24N2O5S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 33080715 |
| Molecular Formula | C16H24N2O5S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate |
| SMILES | CC(C)CCNC(=O)COC(=O)c1sccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C16H24N2O5S2/c1-12(2)5-7-17-14(19)11-23-16(20)15-13(6-10-24-15)25(21,22)18-8-3-4-9-18/h6,10,12H,3-5,7-9,11H2,1-2H3,(H,17,19) |
| InChIKey | DYULKHRMLKLDAY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |