C19H15N5O5 — CID 3101776
N'-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-N-(4-nitrophenyl)oxamide (PubChem CID 3101776) has the molecular formula C19H15N5O5 and a molecular weight of 393.36 g/mol. Its IUPAC name is N'-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-N-(4-nitrophenyl)oxamide.
| Compound Name | N'-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-N-(4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 3101776 |
| Molecular Formula | C19H15N5O5 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N'-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-N-(4-nitrophenyl)oxamide |
| SMILES | C=CCn1c(O)c(/N=N/C(=O)C(=O)Nc2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C19H15N5O5/c1-2-11-23-15-6-4-3-5-14(15)16(19(23)27)21-22-18(26)17(25)20-12-7-9-13(10-8-12)24(28)29/h2-10,27H,1,11H2,(H,20,25)/b22-21+ |
| InChIKey | HLLLIXZTKREJEI-QURGRASLSA-N |
| XLogP | 3.69 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|