C30H24N6O4 — CID 1048805
1-N,4-N-bis[(2-hydroxy-1-prop-2-enylindol-3-yl)imino]benzene-1,4-dicarboxamide (PubChem CID 1048805) has the molecular formula C30H24N6O4 and a molecular weight of 532.56 g/mol. Its IUPAC name is 1-N,4-N-bis[(2-hydroxy-1-prop-2-enylindol-3-yl)imino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(2-hydroxy-1-prop-2-enylindol-3-yl)imino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 1048805 |
| Molecular Formula | C30H24N6O4 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 1-N,4-N-bis[(2-hydroxy-1-prop-2-enylindol-3-yl)imino]benzene-1,4-dicarboxamide |
| SMILES | C=CCn1c(O)c(/N=N/C(=O)c2ccc(C(=O)/N=N/c3c(O)n(CC=C)c4ccccc34)cc2)c2ccccc21 |
| InChI | InChI=1S/C30H24N6O4/c1-3-17-35-23-11-7-5-9-21(23)25(29(35)39)31-33-27(37)19-13-15-20(16-14-19)28(38)34-32-26-22-10-6-8-12-24(22)36(18-4-2)30(26)40/h3-16,39-40H,1-2,17-18H2/b33-31+,34-32+ |
| InChIKey | QJCITEWKNDVWFF-FMWAKIAMSA-N |
| XLogP | 7.23 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|