C22H20N4O3 — CID 135913082
(3R,4S)-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 135913082) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is (3R,4S)-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 135913082 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (3R,4S)-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | C=CCn1c(O)c(/N=N/C(=O)[C@H]2C(=O)NC[C@@H]2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H20N4O3/c1-2-12-26-17-11-7-6-10-15(17)19(22(26)29)24-25-21(28)18-16(13-23-20(18)27)14-8-4-3-5-9-14/h2-11,16,18,29H,1,12-13H2,(H,23,27)/b25-24+/t16-,18-/m1/s1 |
| InChIKey | HCRFZUDJDUFIKT-ZXUQHISHSA-N |
| XLogP | 3.67 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|