C27H24N4O3 — CID 135899334
(3S,4R)-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 135899334) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is (3S,4R)-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 135899334 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (3S,4R)-N-[2-hydroxy-1-(2-phenylethyl)indol-3-yl]imino-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(CCc2ccccc2)c2ccccc12)[C@@H]1C(=O)NC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H24N4O3/c32-25-23(21(17-28-25)19-11-5-2-6-12-19)26(33)30-29-24-20-13-7-8-14-22(20)31(27(24)34)16-15-18-9-3-1-4-10-18/h1-14,21,23,34H,15-17H2,(H,28,32)/b30-29+/t21-,23-/m0/s1 |
| InChIKey | UWJGTROECSPREK-UIWWVYNJSA-N |
| XLogP | 4.73 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|