C21H20N4O3 — CID 135554869
(3R,4R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 135554869) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (3R,4R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 135554869 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (3R,4R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | CCn1c(O)c(/N=N/C(=O)[C@H]2C(=O)NC[C@H]2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H20N4O3/c1-2-25-16-11-7-6-10-14(16)18(21(25)28)23-24-20(27)17-15(12-22-19(17)26)13-8-4-3-5-9-13/h3-11,15,17,28H,2,12H2,1H3,(H,22,26)/b24-23+/t15-,17+/m0/s1 |
| InChIKey | YJBJSDQZROZADX-WYAZJLICSA-N |
| XLogP | 3.51 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|