C23H26ClN4O3+ — CID 2309760
N-[1-(azepan-1-ium-1-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(4-chlorophenoxy)acetamide (PubChem CID 2309760) has the molecular formula C23H26ClN4O3+ and a molecular weight of 441.94 g/mol. Its IUPAC name is N-[1-(azepan-1-ium-1-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[1-(azepan-1-ium-1-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 2309760 |
| Molecular Formula | C23H26ClN4O3+ |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[1-(azepan-1-ium-1-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(4-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)/N=N/c1c(O)n(C[NH+]2CCCCCC2)c2ccccc12 |
| InChI | InChI=1S/C23H25ClN4O3/c24-17-9-11-18(12-10-17)31-15-21(29)25-26-22-19-7-3-4-8-20(19)28(23(22)30)16-27-13-5-1-2-6-14-27/h3-4,7-12,30H,1-2,5-6,13-16H2/p+1/b26-25+ |
| InChIKey | BOMRUZVMNHKODA-OCEACIFDSA-O |
| XLogP | 4.11 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|