C20H22N5O2+ — CID 135848862
N-[2-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-3-yl]iminopyridine-3-carboxamide (PubChem CID 135848862) has the molecular formula C20H22N5O2+ and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[2-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-3-yl]iminopyridine-3-carboxamide.
| Compound Name | N-[2-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-3-yl]iminopyridine-3-carboxamide |
|---|---|
| PubChem CID | 135848862 |
| Molecular Formula | C20H22N5O2+ |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[2-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-3-yl]iminopyridine-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(C[NH+]2CCCCC2)c2ccccc12)c1cccnc1 |
| InChI | InChI=1S/C20H21N5O2/c26-19(15-7-6-10-21-13-15)23-22-18-16-8-2-3-9-17(16)25(20(18)27)14-24-11-4-1-5-12-24/h2-3,6-10,13,27H,1,4-5,11-12,14H2/p+1/b23-22+ |
| InChIKey | AAQVVCGZEYEKPI-GHVJWSGMSA-O |
| XLogP | 2.69 |
| TPSA | 84.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|