C33H26N6O4 — CID 136695965
N-[1-[[(1R)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]iminopyridine-3-carboxamide (PubChem CID 136695965) has the molecular formula C33H26N6O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is N-[1-[[(1R)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]iminopyridine-3-carboxamide.
| Compound Name | N-[1-[[(1R)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]iminopyridine-3-carboxamide |
|---|---|
| PubChem CID | 136695965 |
| Molecular Formula | C33H26N6O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | N-[1-[[(1R)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]iminopyridine-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCc3ccccc3[C@@H]2CN2C(=O)c3ccccc3C2=O)c2ccccc12)c1cccnc1 |
| InChI | InChI=1S/C33H26N6O4/c40-30(22-9-7-16-34-18-22)36-35-29-26-13-5-6-14-27(26)39(33(29)43)20-37-17-15-21-8-1-2-10-23(21)28(37)19-38-31(41)24-11-3-4-12-25(24)32(38)42/h1-14,16,18,28,43H,15,17,19-20H2/b36-35+/t28-/m0/s1 |
| InChIKey | ITXAYJLXZRWHCD-ZGPTZUSQSA-N |
| XLogP | 5.52 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|