C35H29N5O4 — CID 1388991
N-[1-[[(1S)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]imino-2-methylbenzamide (PubChem CID 1388991) has the molecular formula C35H29N5O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is N-[1-[[(1S)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]imino-2-methylbenzamide.
| Compound Name | N-[1-[[(1S)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]imino-2-methylbenzamide |
|---|---|
| PubChem CID | 1388991 |
| Molecular Formula | C35H29N5O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | N-[1-[[(1S)-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-2-hydroxyindol-3-yl]imino-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)/N=N/c1c(O)n(CN2CCc3ccccc3[C@H]2CN2C(=O)c3ccccc3C2=O)c2ccccc12 |
| InChI | InChI=1S/C35H29N5O4/c1-22-10-2-4-12-24(22)32(41)37-36-31-28-16-8-9-17-29(28)40(35(31)44)21-38-19-18-23-11-3-5-13-25(23)30(38)20-39-33(42)26-14-6-7-15-27(26)34(39)43/h2-17,30,44H,18-21H2,1H3/b37-36+/t30-/m1/s1 |
| InChIKey | HSZMLOQMYFUGJI-MPGLDREASA-N |
| XLogP | 6.43 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|