C26H30N2O5 — CID 161462755
cyclohexane;1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;formic acid (PubChem CID 161462755) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is cyclohexane;1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;formic acid.
| Compound Name | cyclohexane;1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;formic acid |
|---|---|
| PubChem CID | 161462755 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | cyclohexane;1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;formic acid |
| SMILES | C1CCCCC1.O=CN1CCc2ccccc2C1CN1C(=O)c2ccccc2C1=O.O=CO |
| InChI | InChI=1S/C19H16N2O3.C6H12.CH2O2/c22-12-20-10-9-13-5-1-2-6-14(13)17(20)11-21-18(23)15-7-3-4-8-16(15)19(21)24;1-2-4-6-5-3-1;2-1-3/h1-8,12,17H,9-11H2;1-6H2;1H,(H,2,3) |
| InChIKey | WCAMOMPJMPAKLI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|