C13H15NO2 — CID 13117673
1-(2-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 13117673) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(2-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 1-(2-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 13117673 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(2-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | CC(=O)CC1c2ccccc2CCN1C=O |
| InChI | InChI=1S/C13H15NO2/c1-10(16)8-13-12-5-3-2-4-11(12)6-7-14(13)9-15/h2-5,9,13H,6-8H2,1H3 |
| InChIKey | ICALAVFACNADMH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|