About 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal
3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal (PubChem CID 54419181) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal.
Molecular Properties
| Compound Name | 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal |
| PubChem CID | 54419181 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal |
| SMILES | CCC1c2ccccc2CCN1C=CC=O |
| InChI | InChI=1S/C14H17NO/c1-2-14-13-7-4-3-6-12(13)8-10-15(14)9-5-11-16/h3-7,9,11,14H,2,8,10H2,1H3 |
| InChIKey | VZPBKZACQPGUEE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal?
The IUPAC name of 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal (CID 54419181) is 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal.
What is the SMILES notation for 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal?
The canonical SMILES for 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal is CCC1c2ccccc2CCN1C=CC=O.
What is the InChIKey of 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal?
The InChIKey is VZPBKZACQPGUEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-2-14-13-7-4-3-6-12(13)8-10-15(14)9-5-11-16/h3-7,9,11,14H,2,8,10H2,1H3.
What are the key properties of 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal?
3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal has a molecular weight of 215.30 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal is sourced from PubChem (CID 54419181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).