C12H13NO — CID 54270364
3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal (PubChem CID 54270364) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal |
|---|---|
| PubChem CID | 54270364 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enal |
| SMILES | O=CC=CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C12H13NO/c14-9-3-7-13-8-6-11-4-1-2-5-12(11)10-13/h1-5,7,9H,6,8,10H2 |
| InChIKey | RJRNXQBSFDWJAI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|